C20H21BrN2O3S — CID 19219670
4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-1,3-benzothiazol-2-yl)butanamide (PubChem CID 19219670) has the molecular formula C20H21BrN2O3S and a molecular weight of 449.37 g/mol. Its IUPAC name is 4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-1,3-benzothiazol-2-yl)butanamide.
| Compound Name | 4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-1,3-benzothiazol-2-yl)butanamide |
|---|---|
| PubChem CID | 19219670 |
| Molecular Formula | C20H21BrN2O3S |
| Molecular Weight | 449.37 g/mol |
| Exact Mass | 448.05 |
| IUPAC Name | 4-(2-bromo-4-ethylphenoxy)-N-(4-methoxy-1,3-benzothiazol-2-yl)butanamide |
| SMILES | CCc1ccc(OCCCC(=O)Nc2nc3c(OC)cccc3s2)c(Br)c1 |
| InChI | InChI=1S/C20H21BrN2O3S/c1-3-13-9-10-15(14(21)12-13)26-11-5-8-18(24)22-20-23-19-16(25-2)6-4-7-17(19)27-20/h4,6-7,9-10,12H,3,5,8,11H2,1-2H3,(H,22,23,24) |
| InChIKey | ODIAJLQWBKJVNS-UHFFFAOYSA-N |
| XLogP | 5.43 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.37 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|