C22H18Cl2N2O2 — CID 19224191
2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-1H-benzimidazole (PubChem CID 19224191) has the molecular formula C22H18Cl2N2O2 and a molecular weight of 413.30 g/mol. Its IUPAC name is 2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-1H-benzimidazole.
| Compound Name | 2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 19224191 |
| Molecular Formula | C22H18Cl2N2O2 |
| Molecular Weight | 413.30 g/mol |
| Exact Mass | 412.07 |
| IUPAC Name | 2-[4-[(2,4-dichlorophenyl)methoxy]-3-ethoxyphenyl]-1H-benzimidazole |
| SMILES | CCOc1cc(-c2nc3ccccc3[nH]2)ccc1OCc1ccc(Cl)cc1Cl |
| InChI | InChI=1S/C22H18Cl2N2O2/c1-2-27-21-11-14(22-25-18-5-3-4-6-19(18)26-22)8-10-20(21)28-13-15-7-9-16(23)12-17(15)24/h3-12H,2,13H2,1H3,(H,25,26) |
| InChIKey | JKRBRVPGLTVNKE-UHFFFAOYSA-N |
| XLogP | 6.51 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 413.30 |
| LogP ≤ 5 | 6.51 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |