C21H15Cl3N2O2 — CID 168555287
2-[3-methoxy-4-[(2,4,6-trichlorophenyl)methoxy]phenyl]-1H-benzimidazole (PubChem CID 168555287) has the molecular formula C21H15Cl3N2O2 and a molecular weight of 433.72 g/mol. Its IUPAC name is 2-[3-methoxy-4-[(2,4,6-trichlorophenyl)methoxy]phenyl]-1H-benzimidazole.
| Compound Name | 2-[3-methoxy-4-[(2,4,6-trichlorophenyl)methoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 168555287 |
| Molecular Formula | C21H15Cl3N2O2 |
| Molecular Weight | 433.72 g/mol |
| Exact Mass | 432.02 |
| IUPAC Name | 2-[3-methoxy-4-[(2,4,6-trichlorophenyl)methoxy]phenyl]-1H-benzimidazole |
| SMILES | COc1cc(-c2nc3ccccc3[nH]2)ccc1OCc1c(Cl)cc(Cl)cc1Cl |
| InChI | InChI=1S/C21H15Cl3N2O2/c1-27-20-8-12(21-25-17-4-2-3-5-18(17)26-21)6-7-19(20)28-11-14-15(23)9-13(22)10-16(14)24/h2-10H,11H2,1H3,(H,25,26) |
| InChIKey | JNSDIXVGADEXLY-UHFFFAOYSA-N |
| XLogP | 6.78 |
| TPSA | 47.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 433.72 |
| LogP ≤ 5 | 6.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |