C23H27N3O2 — CID 91104957
2-[3-methoxy-4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole (PubChem CID 91104957) has the molecular formula C23H27N3O2 and a molecular weight of 377.49 g/mol. Its IUPAC name is 2-[3-methoxy-4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole.
| Compound Name | 2-[3-methoxy-4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole |
|---|---|
| PubChem CID | 91104957 |
| Molecular Formula | C23H27N3O2 |
| Molecular Weight | 377.49 g/mol |
| Exact Mass | 377.21 |
| IUPAC Name | 2-[3-methoxy-4-[(2,2,5,5-tetramethyl-1H-pyrrol-3-yl)methoxy]phenyl]-1H-benzimidazole |
| SMILES | COc1cc(-c2nc3ccccc3[nH]2)ccc1OCC1=CC(C)(C)NC1(C)C |
| InChI | InChI=1S/C23H27N3O2/c1-22(2)13-16(23(3,4)26-22)14-28-19-11-10-15(12-20(19)27-5)21-24-17-8-6-7-9-18(17)25-21/h6-13,26H,14H2,1-5H3,(H,24,25) |
| InChIKey | VFPDMTLCGDCBTJ-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 59.17 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.49 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|