C32H36N2O5S — CID 19227212
ethyl 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate (PubChem CID 19227212) has the molecular formula C32H36N2O5S and a molecular weight of 560.72 g/mol. Its IUPAC name is ethyl 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate.
| Compound Name | ethyl 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19227212 |
| Molecular Formula | C32H36N2O5S |
| Molecular Weight | 560.72 g/mol |
| Exact Mass | 560.23 |
| IUPAC Name | ethyl 2-[[(E)-2-cyano-3-(4-hexoxy-3-methoxyphenyl)prop-2-enoyl]amino]-4-(2,4-dimethylphenyl)thiophene-3-carboxylate |
| SMILES | CCCCCCOc1ccc(/C=C(\C#N)C(=O)Nc2scc(-c3ccc(C)cc3C)c2C(=O)OCC)cc1OC |
| InChI | InChI=1S/C32H36N2O5S/c1-6-8-9-10-15-39-27-14-12-23(18-28(27)37-5)17-24(19-33)30(35)34-31-29(32(36)38-7-2)26(20-40-31)25-13-11-21(3)16-22(25)4/h11-14,16-18,20H,6-10,15H2,1-5H3,(H,34,35)/b24-17+ |
| InChIKey | MITXJEGRVHIBBY-JJIBRWJFSA-N |
| XLogP | 7.72 |
| TPSA | 97.65 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 560.72 |
| LogP ≤ 5 | 7.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|