C18H17N3O5S2 — CID 19228890
N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide (PubChem CID 19228890) has the molecular formula C18H17N3O5S2 and a molecular weight of 419.48 g/mol. Its IUPAC name is N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide.
| Compound Name | N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide |
|---|---|
| PubChem CID | 19228890 |
| Molecular Formula | C18H17N3O5S2 |
| Molecular Weight | 419.48 g/mol |
| Exact Mass | 419.06 |
| IUPAC Name | N-[4-(4-ethoxyphenyl)-5-methyl-1,3-thiazol-2-yl]-2-nitrobenzenesulfonamide |
| SMILES | CCOc1ccc(-c2nc(NS(=O)(=O)c3ccccc3[N+](=O)[O-])sc2C)cc1 |
| InChI | InChI=1S/C18H17N3O5S2/c1-3-26-14-10-8-13(9-11-14)17-12(2)27-18(19-17)20-28(24,25)16-7-5-4-6-15(16)21(22)23/h4-11H,3H2,1-2H3,(H,19,20) |
| InChIKey | BAABUSYDQSAAPM-UHFFFAOYSA-N |
| XLogP | 4.23 |
| TPSA | 111.43 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.48 |
| LogP ≤ 5 | 4.23 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'sulfonamide_F(1)', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|