C29H30N2O3 — CID 19241605
N-naphthalen-1-yl-3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide (PubChem CID 19241605) has the molecular formula C29H30N2O3 and a molecular weight of 454.57 g/mol. Its IUPAC name is N-naphthalen-1-yl-3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide.
| Compound Name | N-naphthalen-1-yl-3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide |
|---|---|
| PubChem CID | 19241605 |
| Molecular Formula | C29H30N2O3 |
| Molecular Weight | 454.57 g/mol |
| Exact Mass | 454.23 |
| IUPAC Name | N-naphthalen-1-yl-3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanamide |
| SMILES | CC12CCC(C(=O)N(C(Cc3ccccc3)C(=O)Nc3cccc4ccccc34)C1=O)C2(C)C |
| InChI | InChI=1S/C29H30N2O3/c1-28(2)22-16-17-29(28,3)27(34)31(26(22)33)24(18-19-10-5-4-6-11-19)25(32)30-23-15-9-13-20-12-7-8-14-21(20)23/h4-15,22,24H,16-18H2,1-3H3,(H,30,32) |
| InChIKey | QWENENQBWYOAIJ-UHFFFAOYSA-N |
| XLogP | 5.20 |
| TPSA | 66.48 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.57 |
| LogP ≤ 5 | 5.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|