C28H32N2O5 — CID 19241527
ethyl 2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]benzoate (PubChem CID 19241527) has the molecular formula C28H32N2O5 and a molecular weight of 476.57 g/mol. Its IUPAC name is ethyl 2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]benzoate.
| Compound Name | ethyl 2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]benzoate |
|---|---|
| PubChem CID | 19241527 |
| Molecular Formula | C28H32N2O5 |
| Molecular Weight | 476.57 g/mol |
| Exact Mass | 476.23 |
| IUPAC Name | ethyl 2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]benzoate |
| SMILES | CCOC(=O)c1ccccc1NC(=O)C(Cc1ccccc1)N1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C28H32N2O5/c1-5-35-25(33)19-13-9-10-14-21(19)29-23(31)22(17-18-11-7-6-8-12-18)30-24(32)20-15-16-28(4,26(30)34)27(20,2)3/h6-14,20,22H,5,15-17H2,1-4H3,(H,29,31) |
| InChIKey | WAAVHSDNWSNKLP-UHFFFAOYSA-N |
| XLogP | 4.22 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.57 |
| LogP ≤ 5 | 4.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|