C34H38N2O5S — CID 19241691
ethyl 4-(2,4-dimethylphenyl)-2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]thiophene-3-carboxylate (PubChem CID 19241691) has the molecular formula C34H38N2O5S and a molecular weight of 586.75 g/mol. Its IUPAC name is ethyl 4-(2,4-dimethylphenyl)-2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]thiophene-3-carboxylate.
| Compound Name | ethyl 4-(2,4-dimethylphenyl)-2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]thiophene-3-carboxylate |
|---|---|
| PubChem CID | 19241691 |
| Molecular Formula | C34H38N2O5S |
| Molecular Weight | 586.75 g/mol |
| Exact Mass | 586.25 |
| IUPAC Name | ethyl 4-(2,4-dimethylphenyl)-2-[[3-phenyl-2-(1,8,8-trimethyl-2,4-dioxo-3-azabicyclo[3.2.1]octan-3-yl)propanoyl]amino]thiophene-3-carboxylate |
| SMILES | CCOC(=O)c1c(-c2ccc(C)cc2C)csc1NC(=O)C(Cc1ccccc1)N1C(=O)C2CCC(C)(C1=O)C2(C)C |
| InChI | InChI=1S/C34H38N2O5S/c1-7-41-31(39)27-24(23-14-13-20(2)17-21(23)3)19-42-29(27)35-28(37)26(18-22-11-9-8-10-12-22)36-30(38)25-15-16-34(6,32(36)40)33(25,4)5/h8-14,17,19,25-26H,7,15-16,18H2,1-6H3,(H,35,37) |
| InChIKey | IPPVSIHUJZSBMH-UHFFFAOYSA-N |
| XLogP | 6.57 |
| TPSA | 92.78 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 586.75 |
| LogP ≤ 5 | 6.57 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'thiophene_amino_Ab(40)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|