C19H20N2O2 — CID 19243458
3-methyl-5-[(3-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepine-1-carbaldehyde (PubChem CID 19243458) has the molecular formula C19H20N2O2 and a molecular weight of 308.38 g/mol. Its IUPAC name is 3-methyl-5-[(3-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepine-1-carbaldehyde.
| Compound Name | 3-methyl-5-[(3-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepine-1-carbaldehyde |
|---|---|
| PubChem CID | 19243458 |
| Molecular Formula | C19H20N2O2 |
| Molecular Weight | 308.38 g/mol |
| Exact Mass | 308.15 |
| IUPAC Name | 3-methyl-5-[(3-methylphenyl)methyl]-4-oxo-2,3-dihydro-1,5-benzodiazepine-1-carbaldehyde |
| SMILES | Cc1cccc(CN2C(=O)C(C)CN(C=O)c3ccccc32)c1 |
| InChI | InChI=1S/C19H20N2O2/c1-14-6-5-7-16(10-14)12-21-18-9-4-3-8-17(18)20(13-22)11-15(2)19(21)23/h3-10,13,15H,11-12H2,1-2H3 |
| InChIKey | ZDQCBMUWSZQFCS-UHFFFAOYSA-N |
| XLogP | 3.14 |
| TPSA | 40.62 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 308.38 |
| LogP ≤ 5 | 3.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|