C13H19ClN4O3S — CID 19245706
5-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylsulfonylpyrimidine-4-carboxamide (PubChem CID 19245706) has the molecular formula C13H19ClN4O3S and a molecular weight of 346.84 g/mol. Its IUPAC name is 5-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylsulfonylpyrimidine-4-carboxamide.
| Compound Name | 5-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylsulfonylpyrimidine-4-carboxamide |
|---|---|
| PubChem CID | 19245706 |
| Molecular Formula | C13H19ClN4O3S |
| Molecular Weight | 346.84 g/mol |
| Exact Mass | 346.09 |
| IUPAC Name | 5-chloro-N-[(1-ethylpyrrolidin-2-yl)methyl]-2-methylsulfonylpyrimidine-4-carboxamide |
| SMILES | CCN1CCCC1CNC(=O)c1nc(S(C)(=O)=O)ncc1Cl |
| InChI | InChI=1S/C13H19ClN4O3S/c1-3-18-6-4-5-9(18)7-15-12(19)11-10(14)8-16-13(17-11)22(2,20)21/h8-9H,3-7H2,1-2H3,(H,15,19) |
| InChIKey | QGQSTOBUAWZUOI-UHFFFAOYSA-N |
| XLogP | 0.75 |
| TPSA | 92.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.84 |
| LogP ≤ 5 | 0.75 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |