C30H19F6N3O5S2 — CID 19254644
N-[2-(trifluoromethyl)phenyl]-2-[2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide (PubChem CID 19254644) has the molecular formula C30H19F6N3O5S2 and a molecular weight of 679.62 g/mol. Its IUPAC name is N-[2-(trifluoromethyl)phenyl]-2-[2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide.
| Compound Name | N-[2-(trifluoromethyl)phenyl]-2-[2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
|---|---|
| PubChem CID | 19254644 |
| Molecular Formula | C30H19F6N3O5S2 |
| Molecular Weight | 679.62 g/mol |
| Exact Mass | 679.07 |
| IUPAC Name | N-[2-(trifluoromethyl)phenyl]-2-[2-[(1R,8R,9R)-5,10,12-trioxo-11-[3-(trifluoromethyl)phenyl]-2,6-dithia-4,11-diazatricyclo[7.3.0.03,7]dodec-3(7)-en-8-yl]phenoxy]acetamide |
| SMILES | O=C(COc1ccccc1[C@@H]1c2sc(=O)[nH]c2S[C@H]2C(=O)N(c3cccc(C(F)(F)F)c3)C(=O)[C@@H]12)Nc1ccccc1C(F)(F)F |
| InChI | InChI=1S/C30H19F6N3O5S2/c31-29(32,33)14-6-5-7-15(12-14)39-26(41)22-21(23-25(38-28(43)46-23)45-24(22)27(39)42)16-8-1-4-11-19(16)44-13-20(40)37-18-10-3-2-9-17(18)30(34,35)36/h1-12,21-22,24H,13H2,(H,37,40)(H,38,43)/t21-,22-,24+/m0/s1 |
| InChIKey | NSOSWMYIVVRXNI-WPFOTENUSA-N |
| XLogP | 6.29 |
| TPSA | 108.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 46 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 679.62 |
| LogP ≤ 5 | 6.29 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiaz_ene_E(8)', 'substructure': 'N/A'}, {'alert_name': 'phthalimide', 'substructure': 'N/A'} |
|---|