C16H21Cl2N3O4S — CID 19257691
1-[2,4-dichloro-5-(propan-2-ylsulfamoyl)benzoyl]piperidine-4-carboxamide (PubChem CID 19257691) has the molecular formula C16H21Cl2N3O4S and a molecular weight of 422.33 g/mol. Its IUPAC name is 1-[2,4-dichloro-5-(propan-2-ylsulfamoyl)benzoyl]piperidine-4-carboxamide.
| Compound Name | 1-[2,4-dichloro-5-(propan-2-ylsulfamoyl)benzoyl]piperidine-4-carboxamide |
|---|---|
| PubChem CID | 19257691 |
| Molecular Formula | C16H21Cl2N3O4S |
| Molecular Weight | 422.33 g/mol |
| Exact Mass | 421.06 |
| IUPAC Name | 1-[2,4-dichloro-5-(propan-2-ylsulfamoyl)benzoyl]piperidine-4-carboxamide |
| SMILES | CC(C)NS(=O)(=O)c1cc(C(=O)N2CCC(C(N)=O)CC2)c(Cl)cc1Cl |
| InChI | InChI=1S/C16H21Cl2N3O4S/c1-9(2)20-26(24,25)14-7-11(12(17)8-13(14)18)16(23)21-5-3-10(4-6-21)15(19)22/h7-10,20H,3-6H2,1-2H3,(H2,19,22) |
| InChIKey | VEYFVIYMFPVFJS-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.33 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |