C18H20N2O4S — CID 19257849
3-(2,3-dihydroindole-1-carbonyl)-N-ethyl-4-methoxybenzenesulfonamide (PubChem CID 19257849) has the molecular formula C18H20N2O4S and a molecular weight of 360.44 g/mol. Its IUPAC name is 3-(2,3-dihydroindole-1-carbonyl)-N-ethyl-4-methoxybenzenesulfonamide.
| Compound Name | 3-(2,3-dihydroindole-1-carbonyl)-N-ethyl-4-methoxybenzenesulfonamide |
|---|---|
| PubChem CID | 19257849 |
| Molecular Formula | C18H20N2O4S |
| Molecular Weight | 360.44 g/mol |
| Exact Mass | 360.11 |
| IUPAC Name | 3-(2,3-dihydroindole-1-carbonyl)-N-ethyl-4-methoxybenzenesulfonamide |
| SMILES | CCNS(=O)(=O)c1ccc(OC)c(C(=O)N2CCc3ccccc32)c1 |
| InChI | InChI=1S/C18H20N2O4S/c1-3-19-25(22,23)14-8-9-17(24-2)15(12-14)18(21)20-11-10-13-6-4-5-7-16(13)20/h4-9,12,19H,3,10-11H2,1-2H3 |
| InChIKey | PSFIYYAUVNIJJR-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 75.71 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.44 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |