C16H14N4O2 — CID 19258585
2,7-dimethyl-N-(3-nitrophenyl)-1,8-naphthyridin-4-amine (PubChem CID 19258585) has the molecular formula C16H14N4O2 and a molecular weight of 294.31 g/mol. Its IUPAC name is 2,7-dimethyl-N-(3-nitrophenyl)-1,8-naphthyridin-4-amine.
| Compound Name | 2,7-dimethyl-N-(3-nitrophenyl)-1,8-naphthyridin-4-amine |
|---|---|
| PubChem CID | 19258585 |
| Molecular Formula | C16H14N4O2 |
| Molecular Weight | 294.31 g/mol |
| Exact Mass | 294.11 |
| IUPAC Name | 2,7-dimethyl-N-(3-nitrophenyl)-1,8-naphthyridin-4-amine |
| SMILES | Cc1ccc2c(Nc3cccc([N+](=O)[O-])c3)cc(C)nc2n1 |
| InChI | InChI=1S/C16H14N4O2/c1-10-6-7-14-15(8-11(2)18-16(14)17-10)19-12-4-3-5-13(9-12)20(21)22/h3-9H,1-2H3,(H,17,18,19) |
| InChIKey | BTDPYEOFIDVAKW-UHFFFAOYSA-N |
| XLogP | 3.90 |
| TPSA | 80.95 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 294.31 |
| LogP ≤ 5 | 3.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|