C17H22ClN3O3 — CID 19263382
4-chloro-N-[(3,4-diethoxyphenyl)methyl]-1-ethylpyrazole-3-carboxamide (PubChem CID 19263382) has the molecular formula C17H22ClN3O3 and a molecular weight of 351.83 g/mol. Its IUPAC name is 4-chloro-N-[(3,4-diethoxyphenyl)methyl]-1-ethylpyrazole-3-carboxamide.
| Compound Name | 4-chloro-N-[(3,4-diethoxyphenyl)methyl]-1-ethylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19263382 |
| Molecular Formula | C17H22ClN3O3 |
| Molecular Weight | 351.83 g/mol |
| Exact Mass | 351.13 |
| IUPAC Name | 4-chloro-N-[(3,4-diethoxyphenyl)methyl]-1-ethylpyrazole-3-carboxamide |
| SMILES | CCOc1ccc(CNC(=O)c2nn(CC)cc2Cl)cc1OCC |
| InChI | InChI=1S/C17H22ClN3O3/c1-4-21-11-13(18)16(20-21)17(22)19-10-12-7-8-14(23-5-2)15(9-12)24-6-3/h7-9,11H,4-6,10H2,1-3H3,(H,19,22) |
| InChIKey | VVHCOVJQROLOER-UHFFFAOYSA-N |
| XLogP | 3.28 |
| TPSA | 65.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 351.83 |
| LogP ≤ 5 | 3.28 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |