C13H21ClN4O2 — CID 19266741
4-chloro-1,5-dimethyl-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide (PubChem CID 19266741) has the molecular formula C13H21ClN4O2 and a molecular weight of 300.79 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyl-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1,5-dimethyl-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19266741 |
| Molecular Formula | C13H21ClN4O2 |
| Molecular Weight | 300.79 g/mol |
| Exact Mass | 300.14 |
| IUPAC Name | 4-chloro-1,5-dimethyl-N-(3-morpholin-4-ylpropyl)pyrazole-3-carboxamide |
| SMILES | Cc1c(Cl)c(C(=O)NCCCN2CCOCC2)nn1C |
| InChI | InChI=1S/C13H21ClN4O2/c1-10-11(14)12(16-17(10)2)13(19)15-4-3-5-18-6-8-20-9-7-18/h3-9H2,1-2H3,(H,15,19) |
| InChIKey | YMOUZTHJBUHSTA-UHFFFAOYSA-N |
| XLogP | 0.83 |
| TPSA | 59.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 300.79 |
| LogP ≤ 5 | 0.83 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|