C11H17ClN4O2 — CID 44823734
4-chloro-1,5-dimethyl-N-[2-(propanoylamino)ethyl]pyrazole-3-carboxamide (PubChem CID 44823734) has the molecular formula C11H17ClN4O2 and a molecular weight of 272.74 g/mol. Its IUPAC name is 4-chloro-1,5-dimethyl-N-[2-(propanoylamino)ethyl]pyrazole-3-carboxamide.
| Compound Name | 4-chloro-1,5-dimethyl-N-[2-(propanoylamino)ethyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 44823734 |
| Molecular Formula | C11H17ClN4O2 |
| Molecular Weight | 272.74 g/mol |
| Exact Mass | 272.10 |
| IUPAC Name | 4-chloro-1,5-dimethyl-N-[2-(propanoylamino)ethyl]pyrazole-3-carboxamide |
| SMILES | CCC(=O)NCCNC(=O)c1nn(C)c(C)c1Cl |
| InChI | InChI=1S/C11H17ClN4O2/c1-4-8(17)13-5-6-14-11(18)10-9(12)7(2)16(3)15-10/h4-6H2,1-3H3,(H,13,17)(H,14,18) |
| InChIKey | SJBPZXNYJQACIQ-UHFFFAOYSA-N |
| XLogP | 0.64 |
| TPSA | 76.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.74 |
| LogP ≤ 5 | 0.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|