C15H19ClN6O4 — CID 19470867
1-[3-[2-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]ethylamino]-3-oxopropyl]pyrazole-3-carboxylic acid (PubChem CID 19470867) has the molecular formula C15H19ClN6O4 and a molecular weight of 382.81 g/mol. Its IUPAC name is 1-[3-[2-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]ethylamino]-3-oxopropyl]pyrazole-3-carboxylic acid.
| Compound Name | 1-[3-[2-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]ethylamino]-3-oxopropyl]pyrazole-3-carboxylic acid |
|---|---|
| PubChem CID | 19470867 |
| Molecular Formula | C15H19ClN6O4 |
| Molecular Weight | 382.81 g/mol |
| Exact Mass | 382.12 |
| IUPAC Name | 1-[3-[2-[(4-chloro-1,5-dimethylpyrazole-3-carbonyl)amino]ethylamino]-3-oxopropyl]pyrazole-3-carboxylic acid |
| SMILES | Cc1c(Cl)c(C(=O)NCCNC(=O)CCn2ccc(C(=O)O)n2)nn1C |
| InChI | InChI=1S/C15H19ClN6O4/c1-9-12(16)13(20-21(9)2)14(24)18-6-5-17-11(23)4-8-22-7-3-10(19-22)15(25)26/h3,7H,4-6,8H2,1-2H3,(H,17,23)(H,18,24)(H,25,26) |
| InChIKey | SWBGTSCOXURYET-UHFFFAOYSA-N |
| XLogP | 0.21 |
| TPSA | 131.14 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 382.81 |
| LogP ≤ 5 | 0.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|