C8H9F2N3O3 — CID 19268601
methyl 2-[[1-(difluoromethyl)pyrazole-3-carbonyl]amino]acetate (PubChem CID 19268601) has the molecular formula C8H9F2N3O3 and a molecular weight of 233.17 g/mol. Its IUPAC name is methyl 2-[[1-(difluoromethyl)pyrazole-3-carbonyl]amino]acetate.
| Compound Name | methyl 2-[[1-(difluoromethyl)pyrazole-3-carbonyl]amino]acetate |
|---|---|
| PubChem CID | 19268601 |
| Molecular Formula | C8H9F2N3O3 |
| Molecular Weight | 233.17 g/mol |
| Exact Mass | 233.06 |
| IUPAC Name | methyl 2-[[1-(difluoromethyl)pyrazole-3-carbonyl]amino]acetate |
| SMILES | COC(=O)CNC(=O)c1ccn(C(F)F)n1 |
| InChI | InChI=1S/C8H9F2N3O3/c1-16-6(14)4-11-7(15)5-2-3-13(12-5)8(9)10/h2-3,8H,4H2,1H3,(H,11,15) |
| InChIKey | AFROBMMMJIUYAJ-UHFFFAOYSA-N |
| XLogP | 0.18 |
| TPSA | 73.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 233.17 |
| LogP ≤ 5 | 0.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |