C7H12N4O — CID 2060975
N-(2-aminoethyl)-2-methylpyrazole-3-carboxamide (PubChem CID 2060975) has the molecular formula C7H12N4O and a molecular weight of 168.20 g/mol. Its IUPAC name is N-(2-aminoethyl)-2-methylpyrazole-3-carboxamide.
| Compound Name | N-(2-aminoethyl)-2-methylpyrazole-3-carboxamide |
|---|---|
| PubChem CID | 2060975 |
| Molecular Formula | C7H12N4O |
| Molecular Weight | 168.20 g/mol |
| Exact Mass | 168.10 |
| IUPAC Name | N-(2-aminoethyl)-2-methylpyrazole-3-carboxamide |
| SMILES | Cn1nccc1C(=O)NCCN |
| InChI | InChI=1S/C7H12N4O/c1-11-6(2-4-10-11)7(12)9-5-3-8/h2,4H,3,5,8H2,1H3,(H,9,12) |
| InChIKey | QGZIEKXDLGNMGU-UHFFFAOYSA-N |
| XLogP | -0.89 |
| TPSA | 72.94 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.20 |
| LogP ≤ 5 | -0.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |