C15H13BrN6O4 — CID 19271712
1-[(4-bromopyrazol-1-yl)methyl]-N-(2-methoxy-4-nitrophenyl)pyrazole-3-carboxamide (PubChem CID 19271712) has the molecular formula C15H13BrN6O4 and a molecular weight of 421.21 g/mol. Its IUPAC name is 1-[(4-bromopyrazol-1-yl)methyl]-N-(2-methoxy-4-nitrophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(4-bromopyrazol-1-yl)methyl]-N-(2-methoxy-4-nitrophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19271712 |
| Molecular Formula | C15H13BrN6O4 |
| Molecular Weight | 421.21 g/mol |
| Exact Mass | 420.02 |
| IUPAC Name | 1-[(4-bromopyrazol-1-yl)methyl]-N-(2-methoxy-4-nitrophenyl)pyrazole-3-carboxamide |
| SMILES | COc1cc([N+](=O)[O-])ccc1NC(=O)c1ccn(Cn2cc(Br)cn2)n1 |
| InChI | InChI=1S/C15H13BrN6O4/c1-26-14-6-11(22(24)25)2-3-12(14)18-15(23)13-4-5-20(19-13)9-21-8-10(16)7-17-21/h2-8H,9H2,1H3,(H,18,23) |
| InChIKey | ODNOSWSVLPTTKH-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 117.11 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.21 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|