C16H16N6O3 — CID 4775157
N-(2,4-dimethylphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 4775157) has the molecular formula C16H16N6O3 and a molecular weight of 340.34 g/mol. Its IUPAC name is N-(2,4-dimethylphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(2,4-dimethylphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 4775157 |
| Molecular Formula | C16H16N6O3 |
| Molecular Weight | 340.34 g/mol |
| Exact Mass | 340.13 |
| IUPAC Name | N-(2,4-dimethylphenyl)-1-[(4-nitropyrazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | Cc1ccc(NC(=O)c2ccn(Cn3cc([N+](=O)[O-])cn3)n2)c(C)c1 |
| InChI | InChI=1S/C16H16N6O3/c1-11-3-4-14(12(2)7-11)18-16(23)15-5-6-20(19-15)10-21-9-13(8-17-21)22(24)25/h3-9H,10H2,1-2H3,(H,18,23) |
| InChIKey | PIILIETWRNFMMS-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 107.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.34 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|