C24H15ClF2N6O6S — CID 19272717
3-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19272717) has the molecular formula C24H15ClF2N6O6S and a molecular weight of 588.94 g/mol. Its IUPAC name is 3-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19272717 |
| Molecular Formula | C24H15ClF2N6O6S |
| Molecular Weight | 588.94 g/mol |
| Exact Mass | 588.04 |
| IUPAC Name | 3-[[1-[(2-chloro-4-nitrophenoxy)methyl]pyrazole-3-carbonyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2nc(C(F)F)cc(-c3ccco3)c2c1NC(=O)c1ccn(COc2ccc([N+](=O)[O-])cc2Cl)n1 |
| InChI | InChI=1S/C24H15ClF2N6O6S/c25-13-8-11(33(36)37)3-4-17(13)39-10-32-6-5-14(31-32)23(35)30-19-18-12(16-2-1-7-38-16)9-15(21(26)27)29-24(18)40-20(19)22(28)34/h1-9,21H,10H2,(H2,28,34)(H,30,35) |
| InChIKey | SZMXAIQIDICVNU-UHFFFAOYSA-N |
| XLogP | 5.64 |
| TPSA | 168.41 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.94 |
| LogP ≤ 5 | 5.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|