C22H14F2N6O6S — CID 19460966
6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19460966) has the molecular formula C22H14F2N6O6S and a molecular weight of 528.45 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19460966 |
| Molecular Formula | C22H14F2N6O6S |
| Molecular Weight | 528.45 g/mol |
| Exact Mass | 528.07 |
| IUPAC Name | 6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2nc(C(F)F)cc(-c3ccco3)c2c1NC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C22H14F2N6O6S/c23-19(24)13-6-12(14-2-1-5-35-14)16-17(18(20(25)31)37-22(16)27-13)28-21(32)15-4-3-11(36-15)9-29-8-10(7-26-29)30(33)34/h1-8,19H,9H2,(H2,25,31)(H,28,32) |
| InChIKey | LPFNHYKWPORBGH-UHFFFAOYSA-N |
| XLogP | 4.59 |
| TPSA | 172.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 528.45 |
| LogP ≤ 5 | 4.59 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|