C25H12Cl5F2N3O5S — CID 19465980
6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19465980) has the molecular formula C25H12Cl5F2N3O5S and a molecular weight of 681.72 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19465980 |
| Molecular Formula | C25H12Cl5F2N3O5S |
| Molecular Weight | 681.72 g/mol |
| Exact Mass | 678.89 |
| IUPAC Name | 6-(difluoromethyl)-4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2nc(C(F)F)cc(-c3ccco3)c2c1NC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H12Cl5F2N3O5S/c26-14-15(27)17(29)20(18(30)16(14)28)39-7-8-3-4-12(40-8)24(37)35-19-13-9(11-2-1-5-38-11)6-10(22(31)32)34-25(13)41-21(19)23(33)36/h1-6,22H,7H2,(H2,33,36)(H,35,37) |
| InChIKey | DZALIFGAAQYDMD-UHFFFAOYSA-N |
| XLogP | 9.28 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 681.72 |
| LogP ≤ 5 | 9.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|