C25H11Cl5F3N3O5S — CID 19465955
4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19465955) has the molecular formula C25H11Cl5F3N3O5S and a molecular weight of 699.71 g/mol. Its IUPAC name is 4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19465955 |
| Molecular Formula | C25H11Cl5F3N3O5S |
| Molecular Weight | 699.71 g/mol |
| Exact Mass | 696.88 |
| IUPAC Name | 4-(furan-2-yl)-3-[[5-[(2,3,4,5,6-pentachlorophenoxy)methyl]furan-2-carbonyl]amino]-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2nc(C(F)(F)F)cc(-c3ccco3)c2c1NC(=O)c1ccc(COc2c(Cl)c(Cl)c(Cl)c(Cl)c2Cl)o1 |
| InChI | InChI=1S/C25H11Cl5F3N3O5S/c26-14-15(27)17(29)20(18(30)16(14)28)40-7-8-3-4-11(41-8)23(38)36-19-13-9(10-2-1-5-39-10)6-12(25(31,32)33)35-24(13)42-21(19)22(34)37/h1-6H,7H2,(H2,34,37)(H,36,38) |
| InChIKey | NPHRRVFVFJLGSB-UHFFFAOYSA-N |
| XLogP | 9.37 |
| TPSA | 120.59 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 699.71 |
| LogP ≤ 5 | 9.37 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|