C24H16F2N6O5S — CID 19460839
6-(difluoromethyl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-4-phenylthieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19460839) has the molecular formula C24H16F2N6O5S and a molecular weight of 538.49 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-4-phenylthieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-4-phenylthieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19460839 |
| Molecular Formula | C24H16F2N6O5S |
| Molecular Weight | 538.49 g/mol |
| Exact Mass | 538.09 |
| IUPAC Name | 6-(difluoromethyl)-3-[[5-[(4-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-4-phenylthieno[2,3-b]pyridine-2-carboxamide |
| SMILES | NC(=O)c1sc2nc(C(F)F)cc(-c3ccccc3)c2c1NC(=O)c1ccc(Cn2cc([N+](=O)[O-])cn2)o1 |
| InChI | InChI=1S/C24H16F2N6O5S/c25-21(26)16-8-15(12-4-2-1-3-5-12)18-19(20(22(27)33)38-24(18)29-16)30-23(34)17-7-6-14(37-17)11-31-10-13(9-28-31)32(35)36/h1-10,21H,11H2,(H2,27,33)(H,30,34) |
| InChIKey | FGKOMBGHCOHOEG-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 38 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.49 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|