C23H15BrF2N6O5S2 — CID 19465326
3-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-6-(difluoromethyl)-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19465326) has the molecular formula C23H15BrF2N6O5S2 and a molecular weight of 637.44 g/mol. Its IUPAC name is 3-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-6-(difluoromethyl)-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-6-(difluoromethyl)-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19465326 |
| Molecular Formula | C23H15BrF2N6O5S2 |
| Molecular Weight | 637.44 g/mol |
| Exact Mass | 635.97 |
| IUPAC Name | 3-[[5-[(4-bromo-3-nitropyrazol-1-yl)methyl]furan-2-carbonyl]amino]-6-(difluoromethyl)-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)c4ccc(Cn5cc(Br)c([N+](=O)[O-])n5)o4)c23)s1 |
| InChI | InChI=1S/C23H15BrF2N6O5S2/c1-9-2-5-15(38-9)11-6-13(19(25)26)28-23-16(11)17(18(39-23)20(27)33)29-22(34)14-4-3-10(37-14)7-31-8-12(24)21(30-31)32(35)36/h2-6,8,19H,7H2,1H3,(H2,27,33)(H,29,34) |
| InChIKey | BOXLGBKWBCPBDM-UHFFFAOYSA-N |
| XLogP | 6.13 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 637.44 |
| LogP ≤ 5 | 6.13 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|