C21H18F2N6O4S2 — CID 19515882
6-(difluoromethyl)-3-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19515882) has the molecular formula C21H18F2N6O4S2 and a molecular weight of 520.54 g/mol. Its IUPAC name is 6-(difluoromethyl)-3-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-3-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19515882 |
| Molecular Formula | C21H18F2N6O4S2 |
| Molecular Weight | 520.54 g/mol |
| Exact Mass | 520.08 |
| IUPAC Name | 6-(difluoromethyl)-3-[[2-(3,5-dimethyl-4-nitropyrazol-1-yl)acetyl]amino]-4-(5-methylthiophen-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)Cn4nc(C)c([N+](=O)[O-])c4C)c23)s1 |
| InChI | InChI=1S/C21H18F2N6O4S2/c1-8-4-5-13(34-8)11-6-12(19(22)23)25-21-15(11)16(18(35-21)20(24)31)26-14(30)7-28-10(3)17(29(32)33)9(2)27-28/h4-6,19H,7H2,1-3H3,(H2,24,31)(H,26,30) |
| InChIKey | BZODJCNQBFAROI-UHFFFAOYSA-N |
| XLogP | 4.73 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 520.54 |
| LogP ≤ 5 | 4.73 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|