C21H19F2N9O6S — CID 19530115
6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[[2-(5-methyl-3,4-dinitropyrazol-1-yl)acetyl]amino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19530115) has the molecular formula C21H19F2N9O6S and a molecular weight of 563.50 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[[2-(5-methyl-3,4-dinitropyrazol-1-yl)acetyl]amino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[[2-(5-methyl-3,4-dinitropyrazol-1-yl)acetyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19530115 |
| Molecular Formula | C21H19F2N9O6S |
| Molecular Weight | 563.50 g/mol |
| Exact Mass | 563.11 |
| IUPAC Name | 6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[[2-(5-methyl-3,4-dinitropyrazol-1-yl)acetyl]amino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1cc(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)Cn4nc([N+](=O)[O-])c([N+](=O)[O-])c4C)c23)c(C)n1 |
| InChI | InChI=1S/C21H19F2N9O6S/c1-4-29-6-11(8(2)27-29)10-5-12(18(22)23)25-21-14(10)15(17(39-21)19(24)34)26-13(33)7-30-9(3)16(31(35)36)20(28-30)32(37)38/h5-6,18H,4,7H2,1-3H3,(H2,24,34)(H,26,33) |
| InChIKey | WNQVOSYREIFYQZ-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 207.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 563.50 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|