C22H22F2N8O4S — CID 19538985
6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19538985) has the molecular formula C22H22F2N8O4S and a molecular weight of 532.53 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19538985 |
| Molecular Formula | C22H22F2N8O4S |
| Molecular Weight | 532.53 g/mol |
| Exact Mass | 532.15 |
| IUPAC Name | 6-(difluoromethyl)-4-(1-ethyl-3-methylpyrazol-4-yl)-3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | CCn1cc(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)C(C)n4nc([N+](=O)[O-])cc4C)c23)c(C)n1 |
| InChI | InChI=1S/C22H22F2N8O4S/c1-5-30-8-13(10(3)28-30)12-7-14(19(23)24)26-22-16(12)17(18(37-22)20(25)33)27-21(34)11(4)31-9(2)6-15(29-31)32(35)36/h6-8,11,19H,5H2,1-4H3,(H2,25,33)(H,27,34) |
| InChIKey | YAAMAAQGFJOOCG-UHFFFAOYSA-N |
| XLogP | 4.14 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.53 |
| LogP ≤ 5 | 4.14 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|