C23H19F3N6O4S — CID 19538916
3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-4-(4-methylphenyl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19538916) has the molecular formula C23H19F3N6O4S and a molecular weight of 532.50 g/mol. Its IUPAC name is 3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-4-(4-methylphenyl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-4-(4-methylphenyl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19538916 |
| Molecular Formula | C23H19F3N6O4S |
| Molecular Weight | 532.50 g/mol |
| Exact Mass | 532.11 |
| IUPAC Name | 3-[2-(5-methyl-3-nitropyrazol-1-yl)propanoylamino]-4-(4-methylphenyl)-6-(trifluoromethyl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)(F)F)nc3sc(C(N)=O)c(NC(=O)C(C)n4nc([N+](=O)[O-])cc4C)c23)cc1 |
| InChI | InChI=1S/C23H19F3N6O4S/c1-10-4-6-13(7-5-10)14-9-15(23(24,25)26)28-22-17(14)18(19(37-22)20(27)33)29-21(34)12(3)31-11(2)8-16(30-31)32(35)36/h4-9,12H,1-3H3,(H2,27,33)(H,29,34) |
| InChIKey | KVGLAQNXUJIABC-UHFFFAOYSA-N |
| XLogP | 5.00 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 532.50 |
| LogP ≤ 5 | 5.00 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|