C19H13BrF2N6O5S — CID 19529808
3-[[2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19529808) has the molecular formula C19H13BrF2N6O5S and a molecular weight of 555.32 g/mol. Its IUPAC name is 3-[[2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[[2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19529808 |
| Molecular Formula | C19H13BrF2N6O5S |
| Molecular Weight | 555.32 g/mol |
| Exact Mass | 553.98 |
| IUPAC Name | 3-[[2-(4-bromo-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(furan-2-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1c(Br)c([N+](=O)[O-])nn1CC(=O)Nc1c(C(N)=O)sc2nc(C(F)F)cc(-c3ccco3)c12 |
| InChI | InChI=1S/C19H13BrF2N6O5S/c1-7-13(20)18(28(31)32)26-27(7)6-11(29)25-14-12-8(10-3-2-4-33-10)5-9(16(21)22)24-19(12)34-15(14)17(23)30/h2-5,16H,6H2,1H3,(H2,23,30)(H,25,29) |
| InChIKey | QMZAUJBQNGEJBZ-UHFFFAOYSA-N |
| XLogP | 4.41 |
| TPSA | 159.18 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 555.32 |
| LogP ≤ 5 | 4.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|