C20H17ClF2N8O4S — CID 19529533
3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(1,5-dimethylpyrazol-4-yl)thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19529533) has the molecular formula C20H17ClF2N8O4S and a molecular weight of 538.92 g/mol. Its IUPAC name is 3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(1,5-dimethylpyrazol-4-yl)thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(1,5-dimethylpyrazol-4-yl)thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19529533 |
| Molecular Formula | C20H17ClF2N8O4S |
| Molecular Weight | 538.92 g/mol |
| Exact Mass | 538.08 |
| IUPAC Name | 3-[[2-(4-chloro-5-methyl-3-nitropyrazol-1-yl)acetyl]amino]-6-(difluoromethyl)-4-(1,5-dimethylpyrazol-4-yl)thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1c(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)Cn4nc([N+](=O)[O-])c(Cl)c4C)c23)cnn1C |
| InChI | InChI=1S/C20H17ClF2N8O4S/c1-7-10(5-25-29(7)3)9-4-11(17(22)23)26-20-13(9)15(16(36-20)18(24)33)27-12(32)6-30-8(2)14(21)19(28-30)31(34)35/h4-5,17H,6H2,1-3H3,(H2,24,33)(H,27,32) |
| InChIKey | DPXKHGCAYPITCP-UHFFFAOYSA-N |
| XLogP | 3.75 |
| TPSA | 163.86 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.92 |
| LogP ≤ 5 | 3.75 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|