C20H16F2N6O4S2 — CID 19534288
6-(difluoromethyl)-4-(5-methylthiophen-2-yl)-3-[2-(4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide (PubChem CID 19534288) has the molecular formula C20H16F2N6O4S2 and a molecular weight of 506.52 g/mol. Its IUPAC name is 6-(difluoromethyl)-4-(5-methylthiophen-2-yl)-3-[2-(4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide.
| Compound Name | 6-(difluoromethyl)-4-(5-methylthiophen-2-yl)-3-[2-(4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
|---|---|
| PubChem CID | 19534288 |
| Molecular Formula | C20H16F2N6O4S2 |
| Molecular Weight | 506.52 g/mol |
| Exact Mass | 506.06 |
| IUPAC Name | 6-(difluoromethyl)-4-(5-methylthiophen-2-yl)-3-[2-(4-nitropyrazol-1-yl)propanoylamino]thieno[2,3-b]pyridine-2-carboxamide |
| SMILES | Cc1ccc(-c2cc(C(F)F)nc3sc(C(N)=O)c(NC(=O)C(C)n4cc([N+](=O)[O-])cn4)c23)s1 |
| InChI | InChI=1S/C20H16F2N6O4S2/c1-8-3-4-13(33-8)11-5-12(17(21)22)25-20-14(11)15(16(34-20)18(23)29)26-19(30)9(2)27-7-10(6-24-27)28(31)32/h3-7,9,17H,1-2H3,(H2,23,29)(H,26,30) |
| InChIKey | ODKAHXWKPKESLY-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 146.04 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 506.52 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|