C20H17N7O4 — CID 19274133
N-(1-benzyl-1,2,4-triazol-3-yl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide (PubChem CID 19274133) has the molecular formula C20H17N7O4 and a molecular weight of 419.40 g/mol. Its IUPAC name is N-(1-benzyl-1,2,4-triazol-3-yl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide.
| Compound Name | N-(1-benzyl-1,2,4-triazol-3-yl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19274133 |
| Molecular Formula | C20H17N7O4 |
| Molecular Weight | 419.40 g/mol |
| Exact Mass | 419.13 |
| IUPAC Name | N-(1-benzyl-1,2,4-triazol-3-yl)-1-[(2-nitrophenoxy)methyl]pyrazole-3-carboxamide |
| SMILES | O=C(Nc1ncn(Cc2ccccc2)n1)c1ccn(COc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C20H17N7O4/c28-19(22-20-21-13-26(24-20)12-15-6-2-1-3-7-15)16-10-11-25(23-16)14-31-18-9-5-4-8-17(18)27(29)30/h1-11,13H,12,14H2,(H,22,24,28) |
| InChIKey | OGJRJYFCONZRAT-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 130.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 419.40 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|