C17H10F4N4O4 — CID 19273935
1-[(2-nitrophenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide (PubChem CID 19273935) has the molecular formula C17H10F4N4O4 and a molecular weight of 410.28 g/mol. Its IUPAC name is 1-[(2-nitrophenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide.
| Compound Name | 1-[(2-nitrophenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19273935 |
| Molecular Formula | C17H10F4N4O4 |
| Molecular Weight | 410.28 g/mol |
| Exact Mass | 410.06 |
| IUPAC Name | 1-[(2-nitrophenoxy)methyl]-N-(2,3,5,6-tetrafluorophenyl)pyrazole-3-carboxamide |
| SMILES | O=C(Nc1c(F)c(F)cc(F)c1F)c1ccn(COc2ccccc2[N+](=O)[O-])n1 |
| InChI | InChI=1S/C17H10F4N4O4/c18-9-7-10(19)15(21)16(14(9)20)22-17(26)11-5-6-24(23-11)8-29-13-4-2-1-3-12(13)25(27)28/h1-7H,8H2,(H,22,26) |
| InChIKey | IOLPUOTYBZIIKA-UHFFFAOYSA-N |
| XLogP | 3.64 |
| TPSA | 99.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.28 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'halogenated_ring_1', 'substructure': 'N/A'}, {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|