C20H26N6O3 — CID 19278082
1-(1-adamantyl)-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-nitropyrazole-3-carboxamide (PubChem CID 19278082) has the molecular formula C20H26N6O3 and a molecular weight of 398.47 g/mol. Its IUPAC name is 1-(1-adamantyl)-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-nitropyrazole-3-carboxamide.
| Compound Name | 1-(1-adamantyl)-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-nitropyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19278082 |
| Molecular Formula | C20H26N6O3 |
| Molecular Weight | 398.47 g/mol |
| Exact Mass | 398.21 |
| IUPAC Name | 1-(1-adamantyl)-N-methyl-N-[(1-methylpyrazol-4-yl)methyl]-4-nitropyrazole-3-carboxamide |
| SMILES | CN(Cc1cnn(C)c1)C(=O)c1nn(C23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-] |
| InChI | InChI=1S/C20H26N6O3/c1-23(10-16-9-21-24(2)11-16)19(27)18-17(26(28)29)12-25(22-18)20-6-13-3-14(7-20)5-15(4-13)8-20/h9,11-15H,3-8,10H2,1-2H3 |
| InChIKey | OMGRSDRIBWMHEJ-UHFFFAOYSA-N |
| XLogP | 2.72 |
| TPSA | 99.09 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 398.47 |
| LogP ≤ 5 | 2.72 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|