C25H29Cl2N5O3 — CID 19279327
[1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19279327) has the molecular formula C25H29Cl2N5O3 and a molecular weight of 518.45 g/mol. Its IUPAC name is [1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | [1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19279327 |
| Molecular Formula | C25H29Cl2N5O3 |
| Molecular Weight | 518.45 g/mol |
| Exact Mass | 517.16 |
| IUPAC Name | [1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | O=C(c1nn(C23CC4CC(CC(C4)C2)C3)cc1[N+](=O)[O-])N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C25H29Cl2N5O3/c26-20-2-1-16(10-21(20)27)14-29-3-5-30(6-4-29)24(33)23-22(32(34)35)15-31(28-23)25-11-17-7-18(12-25)9-19(8-17)13-25/h1-2,10,15,17-19H,3-9,11-14H2 |
| InChIKey | DUXGUOPVJIXZMS-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 518.45 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|