C26H33N5O3 — CID 46248882
[1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone (PubChem CID 46248882) has the molecular formula C26H33N5O3 and a molecular weight of 463.58 g/mol. Its IUPAC name is [1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone.
| Compound Name | [1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 46248882 |
| Molecular Formula | C26H33N5O3 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.26 |
| IUPAC Name | [1-(1-adamantyl)-4-nitropyrazol-3-yl]-[4-(2,5-dimethylphenyl)piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C)c(N2CCN(C(=O)c3nn(C45CC6CC(CC(C6)C4)C5)cc3[N+](=O)[O-])CC2)c1 |
| InChI | InChI=1S/C26H33N5O3/c1-17-3-4-18(2)22(9-17)28-5-7-29(8-6-28)25(32)24-23(31(33)34)16-30(27-24)26-13-19-10-20(14-26)12-21(11-19)15-26/h3-4,9,16,19-21H,5-8,10-15H2,1-2H3 |
| InChIKey | HQTMEQWTRVLQNN-UHFFFAOYSA-N |
| XLogP | 4.30 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 34 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|