C18H23N5O3 — CID 19279283
(1-ethyl-4-nitropyrazol-3-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19279283) has the molecular formula C18H23N5O3 and a molecular weight of 357.41 g/mol. Its IUPAC name is (1-ethyl-4-nitropyrazol-3-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (1-ethyl-4-nitropyrazol-3-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19279283 |
| Molecular Formula | C18H23N5O3 |
| Molecular Weight | 357.41 g/mol |
| Exact Mass | 357.18 |
| IUPAC Name | (1-ethyl-4-nitropyrazol-3-yl)-[4-[(3-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | CCn1cc([N+](=O)[O-])c(C(=O)N2CCN(Cc3cccc(C)c3)CC2)n1 |
| InChI | InChI=1S/C18H23N5O3/c1-3-22-13-16(23(25)26)17(19-22)18(24)21-9-7-20(8-10-21)12-15-6-4-5-14(2)11-15/h4-6,11,13H,3,7-10,12H2,1-2H3 |
| InChIKey | RXTKYJMGOXZAOE-UHFFFAOYSA-N |
| XLogP | 2.08 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 357.41 |
| LogP ≤ 5 | 2.08 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|