C16H17ClN4O4 — CID 20864755
[4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone (PubChem CID 20864755) has the molecular formula C16H17ClN4O4 and a molecular weight of 364.79 g/mol. Its IUPAC name is [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone.
| Compound Name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone |
|---|---|
| PubChem CID | 20864755 |
| Molecular Formula | C16H17ClN4O4 |
| Molecular Weight | 364.79 g/mol |
| Exact Mass | 364.09 |
| IUPAC Name | [4-(5-chloro-2-methylphenyl)piperazin-1-yl]-(5-methyl-4-nitro-1,2-oxazol-3-yl)methanone |
| SMILES | Cc1ccc(Cl)cc1N1CCN(C(=O)c2noc(C)c2[N+](=O)[O-])CC1 |
| InChI | InChI=1S/C16H17ClN4O4/c1-10-3-4-12(17)9-13(10)19-5-7-20(8-6-19)16(22)14-15(21(23)24)11(2)25-18-14/h3-4,9H,5-8H2,1-2H3 |
| InChIKey | HWJBINJCVFJUPX-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.79 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|