C26H29ClN4O4 — CID 167100448
(5-tert-butyl-4-nitro-1,2-oxazol-3-yl)-[4-[(4-chlorophenyl)-(4-methylphenyl)methyl]piperazin-1-yl]methanone (PubChem CID 167100448) has the molecular formula C26H29ClN4O4 and a molecular weight of 497.00 g/mol. Its IUPAC name is (5-tert-butyl-4-nitro-1,2-oxazol-3-yl)-[4-[(4-chlorophenyl)-(4-methylphenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (5-tert-butyl-4-nitro-1,2-oxazol-3-yl)-[4-[(4-chlorophenyl)-(4-methylphenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 167100448 |
| Molecular Formula | C26H29ClN4O4 |
| Molecular Weight | 497.00 g/mol |
| Exact Mass | 496.19 |
| IUPAC Name | (5-tert-butyl-4-nitro-1,2-oxazol-3-yl)-[4-[(4-chlorophenyl)-(4-methylphenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cc1ccc(C(c2ccc(Cl)cc2)N2CCN(C(=O)c3noc(C(C)(C)C)c3[N+](=O)[O-])CC2)cc1 |
| InChI | InChI=1S/C26H29ClN4O4/c1-17-5-7-18(8-6-17)22(19-9-11-20(27)12-10-19)29-13-15-30(16-14-29)25(32)21-23(31(33)34)24(35-28-21)26(2,3)4/h5-12,22H,13-16H2,1-4H3 |
| InChIKey | FGIBPYQYMCHGFE-UHFFFAOYSA-N |
| XLogP | 5.39 |
| TPSA | 92.72 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 497.00 |
| LogP ≤ 5 | 5.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|