C22H23Cl2N4O3+ — CID 172569074
[3-[4-[bis(4-chlorophenyl)methyl]piperazine-1-carbonyl]-5-methyl-1,2-oxazol-4-yl]-hydroxyazanium (PubChem CID 172569074) has the molecular formula C22H23Cl2N4O3+ and a molecular weight of 462.36 g/mol. Its IUPAC name is [3-[4-[bis(4-chlorophenyl)methyl]piperazine-1-carbonyl]-5-methyl-1,2-oxazol-4-yl]-hydroxyazanium.
| Compound Name | [3-[4-[bis(4-chlorophenyl)methyl]piperazine-1-carbonyl]-5-methyl-1,2-oxazol-4-yl]-hydroxyazanium |
|---|---|
| PubChem CID | 172569074 |
| Molecular Formula | C22H23Cl2N4O3+ |
| Molecular Weight | 462.36 g/mol |
| Exact Mass | 461.11 |
| IUPAC Name | [3-[4-[bis(4-chlorophenyl)methyl]piperazine-1-carbonyl]-5-methyl-1,2-oxazol-4-yl]-hydroxyazanium |
| SMILES | Cc1onc(C(=O)N2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)c1[NH2+]O |
| InChI | InChI=1S/C22H22Cl2N4O3/c1-14-19(25-30)20(26-31-14)22(29)28-12-10-27(11-13-28)21(15-2-6-17(23)7-3-15)16-4-8-18(24)9-5-16/h2-9,21,25,30H,10-13H2,1H3/p+1 |
| InChIKey | QHKDWUCHQZRJJG-UHFFFAOYSA-O |
| XLogP | 3.42 |
| TPSA | 86.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.36 |
| LogP ≤ 5 | 3.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|