C21H21Cl2N5O — CID 145315742
(3-aminopyrazol-1-yl)-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 145315742) has the molecular formula C21H21Cl2N5O and a molecular weight of 430.34 g/mol. Its IUPAC name is (3-aminopyrazol-1-yl)-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (3-aminopyrazol-1-yl)-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 145315742 |
| Molecular Formula | C21H21Cl2N5O |
| Molecular Weight | 430.34 g/mol |
| Exact Mass | 429.11 |
| IUPAC Name | (3-aminopyrazol-1-yl)-[4-[bis(4-chlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Nc1ccn(C(=O)N2CCN(C(c3ccc(Cl)cc3)c3ccc(Cl)cc3)CC2)n1 |
| InChI | InChI=1S/C21H21Cl2N5O/c22-17-5-1-15(2-6-17)20(16-3-7-18(23)8-4-16)26-11-13-27(14-12-26)21(29)28-10-9-19(24)25-28/h1-10,20H,11-14H2,(H2,24,25) |
| InChIKey | BTECAMPGMLPCKM-UHFFFAOYSA-N |
| XLogP | 4.15 |
| TPSA | 67.39 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 430.34 |
| LogP ≤ 5 | 4.15 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |