C20H19Cl2N5O3S — CID 19494953
[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone (PubChem CID 19494953) has the molecular formula C20H19Cl2N5O3S and a molecular weight of 480.38 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone.
| Compound Name | [4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone |
|---|---|
| PubChem CID | 19494953 |
| Molecular Formula | C20H19Cl2N5O3S |
| Molecular Weight | 480.38 g/mol |
| Exact Mass | 479.06 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-[4-[(4-nitropyrazol-1-yl)methyl]thiophen-2-yl]methanone |
| SMILES | O=C(c1cc(Cn2cc([N+](=O)[O-])cn2)cs1)N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C20H19Cl2N5O3S/c21-17-2-1-14(7-18(17)22)10-24-3-5-25(6-4-24)20(28)19-8-15(13-31-19)11-26-12-16(9-23-26)27(29)30/h1-2,7-9,12-13H,3-6,10-11H2 |
| InChIKey | ZIQYXBAROUZTPZ-UHFFFAOYSA-N |
| XLogP | 4.17 |
| TPSA | 84.51 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.38 |
| LogP ≤ 5 | 4.17 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|