C15H15Cl2N5O3 — CID 135748007
[4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-(5-nitro-1H-pyrazol-3-yl)methanone (PubChem CID 135748007) has the molecular formula C15H15Cl2N5O3 and a molecular weight of 384.22 g/mol. Its IUPAC name is [4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-(5-nitro-1H-pyrazol-3-yl)methanone.
| Compound Name | [4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-(5-nitro-1H-pyrazol-3-yl)methanone |
|---|---|
| PubChem CID | 135748007 |
| Molecular Formula | C15H15Cl2N5O3 |
| Molecular Weight | 384.22 g/mol |
| Exact Mass | 383.06 |
| IUPAC Name | [4-[(3,4-dichlorophenyl)methyl]piperazin-1-yl]-(5-nitro-1H-pyrazol-3-yl)methanone |
| SMILES | O=C(c1cc([N+](=O)[O-])[nH]n1)N1CCN(Cc2ccc(Cl)c(Cl)c2)CC1 |
| InChI | InChI=1S/C15H15Cl2N5O3/c16-11-2-1-10(7-12(11)17)9-20-3-5-21(6-4-20)15(23)13-8-14(19-18-13)22(24)25/h1-2,7-8H,3-6,9H2,(H,18,19) |
| InChIKey | UGCQHMNZWILXRT-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 95.37 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.22 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|