C14H16ClN9O3 — CID 19278387
N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide (PubChem CID 19278387) has the molecular formula C14H16ClN9O3 and a molecular weight of 393.80 g/mol. Its IUPAC name is N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide.
| Compound Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
|---|---|
| PubChem CID | 19278387 |
| Molecular Formula | C14H16ClN9O3 |
| Molecular Weight | 393.80 g/mol |
| Exact Mass | 393.11 |
| IUPAC Name | N-[(4-chloro-1-ethylpyrazol-3-yl)methyl]-N-methyl-1-[(3-nitro-1,2,4-triazol-1-yl)methyl]pyrazole-3-carboxamide |
| SMILES | CCn1cc(Cl)c(CN(C)C(=O)c2ccn(Cn3cnc([N+](=O)[O-])n3)n2)n1 |
| InChI | InChI=1S/C14H16ClN9O3/c1-3-21-6-10(15)12(18-21)7-20(2)13(25)11-4-5-22(17-11)9-23-8-16-14(19-23)24(26)27/h4-6,8H,3,7,9H2,1-2H3 |
| InChIKey | HYTWCFLJQGNDMN-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 129.80 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 393.80 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|