C16H18Cl2N4O — CID 19279143
(4-chloro-1-methylpyrazol-3-yl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone (PubChem CID 19279143) has the molecular formula C16H18Cl2N4O and a molecular weight of 353.25 g/mol. Its IUPAC name is (4-chloro-1-methylpyrazol-3-yl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone.
| Compound Name | (4-chloro-1-methylpyrazol-3-yl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone |
|---|---|
| PubChem CID | 19279143 |
| Molecular Formula | C16H18Cl2N4O |
| Molecular Weight | 353.25 g/mol |
| Exact Mass | 352.09 |
| IUPAC Name | (4-chloro-1-methylpyrazol-3-yl)-[4-[(3-chlorophenyl)methyl]piperazin-1-yl]methanone |
| SMILES | Cn1cc(Cl)c(C(=O)N2CCN(Cc3cccc(Cl)c3)CC2)n1 |
| InChI | InChI=1S/C16H18Cl2N4O/c1-20-11-14(18)15(19-20)16(23)22-7-5-21(6-8-22)10-12-3-2-4-13(17)9-12/h2-4,9,11H,5-8,10H2,1H3 |
| InChIKey | KXUXESWQTIPAIY-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 41.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.25 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |